About 3-methylidene-1,5-bis[(2-methylpropan-2-yl)oxy]pentane
3-methylidene-1,5-bis[(2-methylpropan-2-yl)oxy]pentane (PubChem CID 146216381) has the molecular formula C14H28O2
and a molecular weight of 228.38 g/mol. Its IUPAC name is 3-methylidene-1,5-bis[(2-methylpropan-2-yl)oxy]pentane.
Molecular Properties
| Compound Name | 3-methylidene-1,5-bis[(2-methylpropan-2-yl)oxy]pentane |
| PubChem CID | 146216381 |
| Molecular Formula | C14H28O2 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.21 |
| IUPAC Name | 3-methylidene-1,5-bis[(2-methylpropan-2-yl)oxy]pentane |
| SMILES | C=C(CCOC(C)(C)C)CCOC(C)(C)C |
| InChI | InChI=1S/C14H28O2/c1-12(8-10-15-13(2,3)4)9-11-16-14(5,6)7/h1,8-11H2,2-7H3 |
| InChIKey | HPXZBZRXPIQXEI-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-methylidene-1,5-bis[(2-methylpropan-2-yl)oxy]pentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylidene-1,5-bis[(2-methylpropan-2-yl)oxy]pentane?
The IUPAC name of 3-methylidene-1,5-bis[(2-methylpropan-2-yl)oxy]pentane (CID 146216381) is 3-methylidene-1,5-bis[(2-methylpropan-2-yl)oxy]pentane.
What is the SMILES notation for 3-methylidene-1,5-bis[(2-methylpropan-2-yl)oxy]pentane?
The canonical SMILES for 3-methylidene-1,5-bis[(2-methylpropan-2-yl)oxy]pentane is C=C(CCOC(C)(C)C)CCOC(C)(C)C.
What is the InChIKey of 3-methylidene-1,5-bis[(2-methylpropan-2-yl)oxy]pentane?
The InChIKey is HPXZBZRXPIQXEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H28O2/c1-12(8-10-15-13(2,3)4)9-11-16-14(5,6)7/h1,8-11H2,2-7H3.
What are the key properties of 3-methylidene-1,5-bis[(2-methylpropan-2-yl)oxy]pentane?
3-methylidene-1,5-bis[(2-methylpropan-2-yl)oxy]pentane has a molecular weight of 228.38 g/mol, XLogP of 3.95, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylidene-1,5-bis[(2-methylpropan-2-yl)oxy]pentane is sourced from PubChem (CID 146216381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).