About N-[(4-bromo-2,6-difluorophenyl)methyl]-3-methyl-N-prop-2-ynylimidazole-4-carboxamide
N-[(4-bromo-2,6-difluorophenyl)methyl]-3-methyl-N-prop-2-ynylimidazole-4-carboxamide (PubChem CID 146216760) has the molecular formula C15H12BrF2N3O
and a molecular weight of 368.18 g/mol. Its IUPAC name is N-[(4-bromo-2,6-difluorophenyl)methyl]-3-methyl-N-prop-2-ynylimidazole-4-carboxamide.
Molecular Properties
| Compound Name | N-[(4-bromo-2,6-difluorophenyl)methyl]-3-methyl-N-prop-2-ynylimidazole-4-carboxamide |
| PubChem CID | 146216760 |
| Molecular Formula | C15H12BrF2N3O |
| Molecular Weight | 368.18 g/mol |
| Exact Mass | 367.01 |
| IUPAC Name | N-[(4-bromo-2,6-difluorophenyl)methyl]-3-methyl-N-prop-2-ynylimidazole-4-carboxamide |
| SMILES | C#CCN(Cc1c(F)cc(Br)cc1F)C(=O)c1cncn1C |
| InChI | InChI=1S/C15H12BrF2N3O/c1-3-4-21(15(22)14-7-19-9-20(14)2)8-11-12(17)5-10(16)6-13(11)18/h1,5-7,9H,4,8H2,2H3 |
| InChIKey | RHZGOJQFMKBEIM-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.18 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(4-bromo-2,6-difluorophenyl)methyl]-3-methyl-N-prop-2-ynylimidazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4-bromo-2,6-difluorophenyl)methyl]-3-methyl-N-prop-2-ynylimidazole-4-carboxamide?
The IUPAC name of N-[(4-bromo-2,6-difluorophenyl)methyl]-3-methyl-N-prop-2-ynylimidazole-4-carboxamide (CID 146216760) is N-[(4-bromo-2,6-difluorophenyl)methyl]-3-methyl-N-prop-2-ynylimidazole-4-carboxamide.
What is the SMILES notation for N-[(4-bromo-2,6-difluorophenyl)methyl]-3-methyl-N-prop-2-ynylimidazole-4-carboxamide?
The canonical SMILES for N-[(4-bromo-2,6-difluorophenyl)methyl]-3-methyl-N-prop-2-ynylimidazole-4-carboxamide is C#CCN(Cc1c(F)cc(Br)cc1F)C(=O)c1cncn1C.
What is the InChIKey of N-[(4-bromo-2,6-difluorophenyl)methyl]-3-methyl-N-prop-2-ynylimidazole-4-carboxamide?
The InChIKey is RHZGOJQFMKBEIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12BrF2N3O/c1-3-4-21(15(22)14-7-19-9-20(14)2)8-11-12(17)5-10(16)6-13(11)18/h1,5-7,9H,4,8H2,2H3.
What are the key properties of N-[(4-bromo-2,6-difluorophenyl)methyl]-3-methyl-N-prop-2-ynylimidazole-4-carboxamide?
N-[(4-bromo-2,6-difluorophenyl)methyl]-3-methyl-N-prop-2-ynylimidazole-4-carboxamide has a molecular weight of 368.18 g/mol, XLogP of 2.74, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4-bromo-2,6-difluorophenyl)methyl]-3-methyl-N-prop-2-ynylimidazole-4-carboxamide is sourced from PubChem (CID 146216760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).