C25H34N4O6S — CID 146217104
4-(1-ethyl-8-oxospiro[6,7-dihydro-4H-pyrazolo[3,4-c]azepine-5,4'-oxane]-3-yl)butyl 4-(methylsulfamoyl)benzoate (PubChem CID 146217104) has the molecular formula C25H34N4O6S and a molecular weight of 518.64 g/mol. Its IUPAC name is 4-(1-ethyl-8-oxospiro[6,7-dihydro-4H-pyrazolo[3,4-c]azepine-5,4'-oxane]-3-yl)butyl 4-(methylsulfamoyl)benzoate.
| Compound Name | 4-(1-ethyl-8-oxospiro[6,7-dihydro-4H-pyrazolo[3,4-c]azepine-5,4'-oxane]-3-yl)butyl 4-(methylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 146217104 |
| Molecular Formula | C25H34N4O6S |
| Molecular Weight | 518.64 g/mol |
| Exact Mass | 518.22 |
| IUPAC Name | 4-(1-ethyl-8-oxospiro[6,7-dihydro-4H-pyrazolo[3,4-c]azepine-5,4'-oxane]-3-yl)butyl 4-(methylsulfamoyl)benzoate |
| SMILES | CCn1nc(CCCCOC(=O)c2ccc(S(=O)(=O)NC)cc2)c2c1C(=O)NCC1(CCOCC1)C2 |
| InChI | InChI=1S/C25H34N4O6S/c1-3-29-22-20(16-25(17-27-23(22)30)11-14-34-15-12-25)21(28-29)6-4-5-13-35-24(31)18-7-9-19(10-8-18)36(32,33)26-2/h7-10,26H,3-6,11-17H2,1-2H3,(H,27,30) |
| InChIKey | FNSSNLXUMZKWAS-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 128.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.64 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|