About 3-[(1S,2R)-2-[[6-oxo-5-(trifluoromethyl)-1H-pyridazin-4-yl]amino]cyclobutyl]oxypropanoic acid
3-[(1S,2R)-2-[[6-oxo-5-(trifluoromethyl)-1H-pyridazin-4-yl]amino]cyclobutyl]oxypropanoic acid (PubChem CID 146218451) has the molecular formula C12H14F3N3O4
and a molecular weight of 321.26 g/mol. Its IUPAC name is 3-[(1S,2R)-2-[[6-oxo-5-(trifluoromethyl)-1H-pyridazin-4-yl]amino]cyclobutyl]oxypropanoic acid.
Molecular Properties
| Compound Name | 3-[(1S,2R)-2-[[6-oxo-5-(trifluoromethyl)-1H-pyridazin-4-yl]amino]cyclobutyl]oxypropanoic acid |
| PubChem CID | 146218451 |
| Molecular Formula | C12H14F3N3O4 |
| Molecular Weight | 321.26 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | 3-[(1S,2R)-2-[[6-oxo-5-(trifluoromethyl)-1H-pyridazin-4-yl]amino]cyclobutyl]oxypropanoic acid |
| SMILES | O=C(O)CCO[C@H]1CC[C@H]1Nc1cn[nH]c(=O)c1C(F)(F)F |
| InChI | InChI=1S/C12H14F3N3O4/c13-12(14,15)10-7(5-16-18-11(10)21)17-6-1-2-8(6)22-4-3-9(19)20/h5-6,8H,1-4H2,(H,19,20)(H2,17,18,21)/t6-,8+/m1/s1 |
| InChIKey | DNPIRIYEWMMWBH-SVRRBLITSA-N |
| XLogP | 1.22 |
| TPSA | 104.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.26 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(1S,2R)-2-[[6-oxo-5-(trifluoromethyl)-1H-pyridazin-4-yl]amino]cyclobutyl]oxypropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1S,2R)-2-[[6-oxo-5-(trifluoromethyl)-1H-pyridazin-4-yl]amino]cyclobutyl]oxypropanoic acid?
The IUPAC name of 3-[(1S,2R)-2-[[6-oxo-5-(trifluoromethyl)-1H-pyridazin-4-yl]amino]cyclobutyl]oxypropanoic acid (CID 146218451) is 3-[(1S,2R)-2-[[6-oxo-5-(trifluoromethyl)-1H-pyridazin-4-yl]amino]cyclobutyl]oxypropanoic acid.
What is the SMILES notation for 3-[(1S,2R)-2-[[6-oxo-5-(trifluoromethyl)-1H-pyridazin-4-yl]amino]cyclobutyl]oxypropanoic acid?
The canonical SMILES for 3-[(1S,2R)-2-[[6-oxo-5-(trifluoromethyl)-1H-pyridazin-4-yl]amino]cyclobutyl]oxypropanoic acid is O=C(O)CCO[C@H]1CC[C@H]1Nc1cn[nH]c(=O)c1C(F)(F)F.
What is the InChIKey of 3-[(1S,2R)-2-[[6-oxo-5-(trifluoromethyl)-1H-pyridazin-4-yl]amino]cyclobutyl]oxypropanoic acid?
The InChIKey is DNPIRIYEWMMWBH-SVRRBLITSA-N. The full InChI is InChI=1S/C12H14F3N3O4/c13-12(14,15)10-7(5-16-18-11(10)21)17-6-1-2-8(6)22-4-3-9(19)20/h5-6,8H,1-4H2,(H,19,20)(H2,17,18,21)/t6-,8+/m1/s1.
What are the key properties of 3-[(1S,2R)-2-[[6-oxo-5-(trifluoromethyl)-1H-pyridazin-4-yl]amino]cyclobutyl]oxypropanoic acid?
3-[(1S,2R)-2-[[6-oxo-5-(trifluoromethyl)-1H-pyridazin-4-yl]amino]cyclobutyl]oxypropanoic acid has a molecular weight of 321.26 g/mol, XLogP of 1.22, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1S,2R)-2-[[6-oxo-5-(trifluoromethyl)-1H-pyridazin-4-yl]amino]cyclobutyl]oxypropanoic acid is sourced from PubChem (CID 146218451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).