C18H22Cl2N6O4 — CID 146218674
5-chloro-4-[(2S)-1-[3-[4-(5-chloropyrimidin-2-yl)piperazin-1-yl]-3-oxopropoxy]propan-2-yl]oxy-1H-pyridazin-6-one (PubChem CID 146218674) has the molecular formula C18H22Cl2N6O4 and a molecular weight of 457.32 g/mol. Its IUPAC name is 5-chloro-4-[(2S)-1-[3-[4-(5-chloropyrimidin-2-yl)piperazin-1-yl]-3-oxopropoxy]propan-2-yl]oxy-1H-pyridazin-6-one.
| Compound Name | 5-chloro-4-[(2S)-1-[3-[4-(5-chloropyrimidin-2-yl)piperazin-1-yl]-3-oxopropoxy]propan-2-yl]oxy-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 146218674 |
| Molecular Formula | C18H22Cl2N6O4 |
| Molecular Weight | 457.32 g/mol |
| Exact Mass | 456.11 |
| IUPAC Name | 5-chloro-4-[(2S)-1-[3-[4-(5-chloropyrimidin-2-yl)piperazin-1-yl]-3-oxopropoxy]propan-2-yl]oxy-1H-pyridazin-6-one |
| SMILES | C[C@@H](COCCC(=O)N1CCN(c2ncc(Cl)cn2)CC1)Oc1cn[nH]c(=O)c1Cl |
| InChI | InChI=1S/C18H22Cl2N6O4/c1-12(30-14-10-23-24-17(28)16(14)20)11-29-7-2-15(27)25-3-5-26(6-4-25)18-21-8-13(19)9-22-18/h8-10,12H,2-7,11H2,1H3,(H,24,28)/t12-/m0/s1 |
| InChIKey | MABKYRSCUUBBBP-LBPRGKRZSA-N |
| XLogP | 1.39 |
| TPSA | 113.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.32 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|