About 4-(2-chloro-5,7-dihydropyrrolo[3,4-b]pyridin-6-yl)-5-(trifluoromethyl)-1H-pyridazin-6-one
4-(2-chloro-5,7-dihydropyrrolo[3,4-b]pyridin-6-yl)-5-(trifluoromethyl)-1H-pyridazin-6-one (PubChem CID 146218732) has the molecular formula C12H8ClF3N4O
and a molecular weight of 316.67 g/mol. Its IUPAC name is 4-(2-chloro-5,7-dihydropyrrolo[3,4-b]pyridin-6-yl)-5-(trifluoromethyl)-1H-pyridazin-6-one.
Molecular Properties
| Compound Name | 4-(2-chloro-5,7-dihydropyrrolo[3,4-b]pyridin-6-yl)-5-(trifluoromethyl)-1H-pyridazin-6-one |
| PubChem CID | 146218732 |
| Molecular Formula | C12H8ClF3N4O |
| Molecular Weight | 316.67 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | 4-(2-chloro-5,7-dihydropyrrolo[3,4-b]pyridin-6-yl)-5-(trifluoromethyl)-1H-pyridazin-6-one |
| SMILES | O=c1[nH]ncc(N2Cc3ccc(Cl)nc3C2)c1C(F)(F)F |
| InChI | InChI=1S/C12H8ClF3N4O/c13-9-2-1-6-4-20(5-7(6)18-9)8-3-17-19-11(21)10(8)12(14,15)16/h1-3H,4-5H2,(H,19,21) |
| InChIKey | KUHMNUCCNIVXSY-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.67 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-chloro-5,7-dihydropyrrolo[3,4-b]pyridin-6-yl)-5-(trifluoromethyl)-1H-pyridazin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-chloro-5,7-dihydropyrrolo[3,4-b]pyridin-6-yl)-5-(trifluoromethyl)-1H-pyridazin-6-one?
The IUPAC name of 4-(2-chloro-5,7-dihydropyrrolo[3,4-b]pyridin-6-yl)-5-(trifluoromethyl)-1H-pyridazin-6-one (CID 146218732) is 4-(2-chloro-5,7-dihydropyrrolo[3,4-b]pyridin-6-yl)-5-(trifluoromethyl)-1H-pyridazin-6-one.
What is the SMILES notation for 4-(2-chloro-5,7-dihydropyrrolo[3,4-b]pyridin-6-yl)-5-(trifluoromethyl)-1H-pyridazin-6-one?
The canonical SMILES for 4-(2-chloro-5,7-dihydropyrrolo[3,4-b]pyridin-6-yl)-5-(trifluoromethyl)-1H-pyridazin-6-one is O=c1[nH]ncc(N2Cc3ccc(Cl)nc3C2)c1C(F)(F)F.
What is the InChIKey of 4-(2-chloro-5,7-dihydropyrrolo[3,4-b]pyridin-6-yl)-5-(trifluoromethyl)-1H-pyridazin-6-one?
The InChIKey is KUHMNUCCNIVXSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8ClF3N4O/c13-9-2-1-6-4-20(5-7(6)18-9)8-3-17-19-11(21)10(8)12(14,15)16/h1-3H,4-5H2,(H,19,21).
What are the key properties of 4-(2-chloro-5,7-dihydropyrrolo[3,4-b]pyridin-6-yl)-5-(trifluoromethyl)-1H-pyridazin-6-one?
4-(2-chloro-5,7-dihydropyrrolo[3,4-b]pyridin-6-yl)-5-(trifluoromethyl)-1H-pyridazin-6-one has a molecular weight of 316.67 g/mol, XLogP of 2.36, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-chloro-5,7-dihydropyrrolo[3,4-b]pyridin-6-yl)-5-(trifluoromethyl)-1H-pyridazin-6-one is sourced from PubChem (CID 146218732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).