C10H19NO4 — CID 146218818
methyl 3-[(2,2-dimethyl-1,3-oxazolidin-4-yl)methoxy]propanoate (PubChem CID 146218818) has the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. Its IUPAC name is methyl 3-[(2,2-dimethyl-1,3-oxazolidin-4-yl)methoxy]propanoate.
| Compound Name | methyl 3-[(2,2-dimethyl-1,3-oxazolidin-4-yl)methoxy]propanoate |
|---|---|
| PubChem CID | 146218818 |
| Molecular Formula | C10H19NO4 |
| Molecular Weight | 217.26 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | methyl 3-[(2,2-dimethyl-1,3-oxazolidin-4-yl)methoxy]propanoate |
| SMILES | COC(=O)CCOCC1COC(C)(C)N1 |
| InChI | InChI=1S/C10H19NO4/c1-10(2)11-8(7-15-10)6-14-5-4-9(12)13-3/h8,11H,4-7H2,1-3H3 |
| InChIKey | RJIDSYOJOPEUHP-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.26 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|