About 4-[(1S)-1-methyl-1,3-dihydroisoindol-2-yl]-5-(trifluoromethyl)-1H-pyridazin-6-one
4-[(1S)-1-methyl-1,3-dihydroisoindol-2-yl]-5-(trifluoromethyl)-1H-pyridazin-6-one (PubChem CID 146218929) has the molecular formula C14H12F3N3O
and a molecular weight of 295.26 g/mol. Its IUPAC name is 4-[(1S)-1-methyl-1,3-dihydroisoindol-2-yl]-5-(trifluoromethyl)-1H-pyridazin-6-one.
Molecular Properties
| Compound Name | 4-[(1S)-1-methyl-1,3-dihydroisoindol-2-yl]-5-(trifluoromethyl)-1H-pyridazin-6-one |
| PubChem CID | 146218929 |
| Molecular Formula | C14H12F3N3O |
| Molecular Weight | 295.26 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | 4-[(1S)-1-methyl-1,3-dihydroisoindol-2-yl]-5-(trifluoromethyl)-1H-pyridazin-6-one |
| SMILES | C[C@H]1c2ccccc2CN1c1cn[nH]c(=O)c1C(F)(F)F |
| InChI | InChI=1S/C14H12F3N3O/c1-8-10-5-3-2-4-9(10)7-20(8)11-6-18-19-13(21)12(11)14(15,16)17/h2-6,8H,7H2,1H3,(H,19,21)/t8-/m0/s1 |
| InChIKey | UJPGEQVEIAKFNQ-QMMMGPOBSA-N |
| XLogP | 2.87 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.26 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[(1S)-1-methyl-1,3-dihydroisoindol-2-yl]-5-(trifluoromethyl)-1H-pyridazin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1S)-1-methyl-1,3-dihydroisoindol-2-yl]-5-(trifluoromethyl)-1H-pyridazin-6-one?
The IUPAC name of 4-[(1S)-1-methyl-1,3-dihydroisoindol-2-yl]-5-(trifluoromethyl)-1H-pyridazin-6-one (CID 146218929) is 4-[(1S)-1-methyl-1,3-dihydroisoindol-2-yl]-5-(trifluoromethyl)-1H-pyridazin-6-one.
What is the SMILES notation for 4-[(1S)-1-methyl-1,3-dihydroisoindol-2-yl]-5-(trifluoromethyl)-1H-pyridazin-6-one?
The canonical SMILES for 4-[(1S)-1-methyl-1,3-dihydroisoindol-2-yl]-5-(trifluoromethyl)-1H-pyridazin-6-one is C[C@H]1c2ccccc2CN1c1cn[nH]c(=O)c1C(F)(F)F.
What is the InChIKey of 4-[(1S)-1-methyl-1,3-dihydroisoindol-2-yl]-5-(trifluoromethyl)-1H-pyridazin-6-one?
The InChIKey is UJPGEQVEIAKFNQ-QMMMGPOBSA-N. The full InChI is InChI=1S/C14H12F3N3O/c1-8-10-5-3-2-4-9(10)7-20(8)11-6-18-19-13(21)12(11)14(15,16)17/h2-6,8H,7H2,1H3,(H,19,21)/t8-/m0/s1.
What are the key properties of 4-[(1S)-1-methyl-1,3-dihydroisoindol-2-yl]-5-(trifluoromethyl)-1H-pyridazin-6-one?
4-[(1S)-1-methyl-1,3-dihydroisoindol-2-yl]-5-(trifluoromethyl)-1H-pyridazin-6-one has a molecular weight of 295.26 g/mol, XLogP of 2.87, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1S)-1-methyl-1,3-dihydroisoindol-2-yl]-5-(trifluoromethyl)-1H-pyridazin-6-one is sourced from PubChem (CID 146218929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).