C17H20O2 — CID 146220238
(2,3,4,4-tetramethyl-9-tricyclo[5.3.1.01,5]undeca-2,5,7,9-tetraenyl) acetate (PubChem CID 146220238) has the molecular formula C17H20O2 and a molecular weight of 256.34 g/mol. Its IUPAC name is (2,3,4,4-tetramethyl-9-tricyclo[5.3.1.01,5]undeca-2,5,7,9-tetraenyl) acetate.
| Compound Name | (2,3,4,4-tetramethyl-9-tricyclo[5.3.1.01,5]undeca-2,5,7,9-tetraenyl) acetate |
|---|---|
| PubChem CID | 146220238 |
| Molecular Formula | C17H20O2 |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | (2,3,4,4-tetramethyl-9-tricyclo[5.3.1.01,5]undeca-2,5,7,9-tetraenyl) acetate |
| SMILES | CC(=O)OC1=CC23CC(=C1)C=C2C(C)(C)C(C)=C3C |
| InChI | InChI=1S/C17H20O2/c1-10-11(2)17-8-13(7-15(17)16(10,4)5)6-14(9-17)19-12(3)18/h6-7,9H,8H2,1-5H3 |
| InChIKey | PHPJUBOYBOOBAM-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|