C10H12FNO2 — CID 146220861
(2E,4E,5Z)-4-(1-fluoroethylidene)-6-(methylideneamino)hepta-2,5-dienoic acid (PubChem CID 146220861) has the molecular formula C10H12FNO2 and a molecular weight of 197.21 g/mol. Its IUPAC name is (2E,4E,5Z)-4-(1-fluoroethylidene)-6-(methylideneamino)hepta-2,5-dienoic acid.
| Compound Name | (2E,4E,5Z)-4-(1-fluoroethylidene)-6-(methylideneamino)hepta-2,5-dienoic acid |
|---|---|
| PubChem CID | 146220861 |
| Molecular Formula | C10H12FNO2 |
| Molecular Weight | 197.21 g/mol |
| Exact Mass | 197.09 |
| IUPAC Name | (2E,4E,5Z)-4-(1-fluoroethylidene)-6-(methylideneamino)hepta-2,5-dienoic acid |
| SMILES | C=N/C(C)=C\C(\C=C\C(=O)O)=C(/C)F |
| InChI | InChI=1S/C10H12FNO2/c1-7(12-3)6-9(8(2)11)4-5-10(13)14/h4-6H,3H2,1-2H3,(H,13,14)/b5-4+,7-6-,9-8+ |
| InChIKey | MEOIEKFWSVCLKT-QCPPJIGLSA-N |
| XLogP | 2.48 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.21 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|