C28H39N — CID 146221058
[5-[(1E)-2-(2-tert-butyl-5-methylcyclohexa-1,3-dien-1-yl)-3-methylbuta-1,3-dienyl]-1-ethenyl-2,4-dimethylcyclohepta-3,5-dien-1-yl]methanimine (PubChem CID 146221058) has the molecular formula C28H39N and a molecular weight of 389.63 g/mol. Its IUPAC name is [5-[(1E)-2-(2-tert-butyl-5-methylcyclohexa-1,3-dien-1-yl)-3-methylbuta-1,3-dienyl]-1-ethenyl-2,4-dimethylcyclohepta-3,5-dien-1-yl]methanimine.
| Compound Name | [5-[(1E)-2-(2-tert-butyl-5-methylcyclohexa-1,3-dien-1-yl)-3-methylbuta-1,3-dienyl]-1-ethenyl-2,4-dimethylcyclohepta-3,5-dien-1-yl]methanimine |
|---|---|
| PubChem CID | 146221058 |
| Molecular Formula | C28H39N |
| Molecular Weight | 389.63 g/mol |
| Exact Mass | 389.31 |
| IUPAC Name | [5-[(1E)-2-(2-tert-butyl-5-methylcyclohexa-1,3-dien-1-yl)-3-methylbuta-1,3-dienyl]-1-ethenyl-2,4-dimethylcyclohepta-3,5-dien-1-yl]methanimine |
| SMILES | [H]/N=C/C1(C=C)CC=C(/C=C(\C(=C)C)C2=C(C(C)(C)C)C=CC(C)C2)C(C)=CC1C |
| InChI | InChI=1S/C28H39N/c1-10-28(18-29)14-13-23(21(5)16-22(28)6)17-24(19(2)3)25-15-20(4)11-12-26(25)27(7,8)9/h10-13,16-18,20,22,29H,1-2,14-15H2,3-9H3/b24-17+,29-18+ |
| InChIKey | SSCZRWLXPSANEK-ZIESHWKISA-N |
| XLogP | 8.16 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.63 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|