C16H17NO2 — CID 14622137
[(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-naphthalen-1-ylmethanone (PubChem CID 14622137) has the molecular formula C16H17NO2 and a molecular weight of 255.32 g/mol. Its IUPAC name is [(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-naphthalen-1-ylmethanone.
| Compound Name | [(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-naphthalen-1-ylmethanone |
|---|---|
| PubChem CID | 14622137 |
| Molecular Formula | C16H17NO2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | [(2S)-2-(hydroxymethyl)pyrrolidin-1-yl]-naphthalen-1-ylmethanone |
| SMILES | O=C(c1cccc2ccccc12)N1CCC[C@H]1CO |
| InChI | InChI=1S/C16H17NO2/c18-11-13-7-4-10-17(13)16(19)15-9-3-6-12-5-1-2-8-14(12)15/h1-3,5-6,8-9,13,18H,4,7,10-11H2/t13-/m0/s1 |
| InChIKey | XCYLAISFAKGUOY-ZDUSSCGKSA-N |
| XLogP | 2.44 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |