3,5-dichloro-4-prop-2-enoyloxybenzoic acid

C10H6Cl2O4 — CID 146222722

IUPAC3,5-dichloro-4-prop-2-enoyloxybenzoic acid
SMILESC=CC(=O)Oc1c(Cl)cc(C(=O)O)cc1Cl
InChIInChI=1S/C10H6Cl2O4/c1-2-8(13)16-9-6(11)3-5(10(14)15)4-7(9)12/h2-4H,1H2,(H,14,15)
InChIKeyFSJHFJHSKFRUAQ-UHFFFAOYSA-N
MW261.06 g/mol
LogP2.78
Rot. Bonds3

About 3,5-dichloro-4-prop-2-enoyloxybenzoic acid

3,5-dichloro-4-prop-2-enoyloxybenzoic acid (PubChem CID 146222722) has the molecular formula C10H6Cl2O4 and a molecular weight of 261.06 g/mol. Its IUPAC name is 3,5-dichloro-4-prop-2-enoyloxybenzoic acid.

Molecular Properties

Compound Name3,5-dichloro-4-prop-2-enoyloxybenzoic acid
PubChem CID146222722
Molecular FormulaC10H6Cl2O4
Molecular Weight261.06 g/mol
Exact Mass259.96
IUPAC Name3,5-dichloro-4-prop-2-enoyloxybenzoic acid
SMILESC=CC(=O)Oc1c(Cl)cc(C(=O)O)cc1Cl
InChIInChI=1S/C10H6Cl2O4/c1-2-8(13)16-9-6(11)3-5(10(14)15)4-7(9)12/h2-4H,1H2,(H,14,15)
InChIKeyFSJHFJHSKFRUAQ-UHFFFAOYSA-N
XLogP2.78
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500261.06
LogP ≤ 52.78
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}

Analyze 3,5-dichloro-4-prop-2-enoyloxybenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,5-dichloro-4-prop-2-enoyloxybenzoic acid?
The IUPAC name of 3,5-dichloro-4-prop-2-enoyloxybenzoic acid (CID 146222722) is 3,5-dichloro-4-prop-2-enoyloxybenzoic acid.
What is the SMILES notation for 3,5-dichloro-4-prop-2-enoyloxybenzoic acid?
The canonical SMILES for 3,5-dichloro-4-prop-2-enoyloxybenzoic acid is C=CC(=O)Oc1c(Cl)cc(C(=O)O)cc1Cl.
What is the InChIKey of 3,5-dichloro-4-prop-2-enoyloxybenzoic acid?
The InChIKey is FSJHFJHSKFRUAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6Cl2O4/c1-2-8(13)16-9-6(11)3-5(10(14)15)4-7(9)12/h2-4H,1H2,(H,14,15).
What are the key properties of 3,5-dichloro-4-prop-2-enoyloxybenzoic acid?
3,5-dichloro-4-prop-2-enoyloxybenzoic acid has a molecular weight of 261.06 g/mol, XLogP of 2.78, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dichloro-4-prop-2-enoyloxybenzoic acid is sourced from PubChem (CID 146222722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).