C20H19FN4OS — CID 146222893
5-[3-[(4aS,6S,8aS)-2-amino-4a-fluoro-6-methyl-4,5,6,8-tetrahydropyrano[3,4-d][1,3]thiazin-8a-yl]phenyl]pyridine-3-carbonitrile (PubChem CID 146222893) has the molecular formula C20H19FN4OS and a molecular weight of 382.46 g/mol. Its IUPAC name is 5-[3-[(4aS,6S,8aS)-2-amino-4a-fluoro-6-methyl-4,5,6,8-tetrahydropyrano[3,4-d][1,3]thiazin-8a-yl]phenyl]pyridine-3-carbonitrile.
| Compound Name | 5-[3-[(4aS,6S,8aS)-2-amino-4a-fluoro-6-methyl-4,5,6,8-tetrahydropyrano[3,4-d][1,3]thiazin-8a-yl]phenyl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 146222893 |
| Molecular Formula | C20H19FN4OS |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | 5-[3-[(4aS,6S,8aS)-2-amino-4a-fluoro-6-methyl-4,5,6,8-tetrahydropyrano[3,4-d][1,3]thiazin-8a-yl]phenyl]pyridine-3-carbonitrile |
| SMILES | C[C@H]1C[C@@]2(F)CSC(N)=N[C@@]2(c2cccc(-c3cncc(C#N)c3)c2)CO1 |
| InChI | InChI=1S/C20H19FN4OS/c1-13-7-19(21)12-27-18(23)25-20(19,11-26-13)17-4-2-3-15(6-17)16-5-14(8-22)9-24-10-16/h2-6,9-10,13H,7,11-12H2,1H3,(H2,23,25)/t13-,19+,20+/m0/s1 |
| InChIKey | MGYOYQWYUFBYID-CJMONDIMSA-N |
| XLogP | 3.39 |
| TPSA | 84.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |