About dimethylamino-[[(2S,6R)-6-hydroxymorpholin-2-yl]methoxy]-oxophosphanium
dimethylamino-[[(2S,6R)-6-hydroxymorpholin-2-yl]methoxy]-oxophosphanium (PubChem CID 146223228) has the molecular formula C7H16N2O4P+
and a molecular weight of 223.19 g/mol. Its IUPAC name is dimethylamino-[[(2S,6R)-6-hydroxymorpholin-2-yl]methoxy]-oxophosphanium.
Molecular Properties
| Compound Name | dimethylamino-[[(2S,6R)-6-hydroxymorpholin-2-yl]methoxy]-oxophosphanium |
| PubChem CID | 146223228 |
| Molecular Formula | C7H16N2O4P+ |
| Molecular Weight | 223.19 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | dimethylamino-[[(2S,6R)-6-hydroxymorpholin-2-yl]methoxy]-oxophosphanium |
| SMILES | CN(C)[P+](=O)OC[C@@H]1CNC[C@H](O)O1 |
| InChI | InChI=1S/C7H16N2O4P/c1-9(2)14(11)12-5-6-3-8-4-7(10)13-6/h6-8,10H,3-5H2,1-2H3/q+1/t6-,7+/m0/s1 |
| InChIKey | QBJKEWNJJXRNRQ-NKWVEPMBSA-N |
| XLogP | -0.47 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.19 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dimethylamino-[[(2S,6R)-6-hydroxymorpholin-2-yl]methoxy]-oxophosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethylamino-[[(2S,6R)-6-hydroxymorpholin-2-yl]methoxy]-oxophosphanium?
The IUPAC name of dimethylamino-[[(2S,6R)-6-hydroxymorpholin-2-yl]methoxy]-oxophosphanium (CID 146223228) is dimethylamino-[[(2S,6R)-6-hydroxymorpholin-2-yl]methoxy]-oxophosphanium.
What is the SMILES notation for dimethylamino-[[(2S,6R)-6-hydroxymorpholin-2-yl]methoxy]-oxophosphanium?
The canonical SMILES for dimethylamino-[[(2S,6R)-6-hydroxymorpholin-2-yl]methoxy]-oxophosphanium is CN(C)[P+](=O)OC[C@@H]1CNC[C@H](O)O1.
What is the InChIKey of dimethylamino-[[(2S,6R)-6-hydroxymorpholin-2-yl]methoxy]-oxophosphanium?
The InChIKey is QBJKEWNJJXRNRQ-NKWVEPMBSA-N. The full InChI is InChI=1S/C7H16N2O4P/c1-9(2)14(11)12-5-6-3-8-4-7(10)13-6/h6-8,10H,3-5H2,1-2H3/q+1/t6-,7+/m0/s1.
What are the key properties of dimethylamino-[[(2S,6R)-6-hydroxymorpholin-2-yl]methoxy]-oxophosphanium?
dimethylamino-[[(2S,6R)-6-hydroxymorpholin-2-yl]methoxy]-oxophosphanium has a molecular weight of 223.19 g/mol, XLogP of -0.47, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dimethylamino-[[(2S,6R)-6-hydroxymorpholin-2-yl]methoxy]-oxophosphanium is sourced from PubChem (CID 146223228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).