C12H12ClF2NO3 — CID 146223658
[(1S,2R)-1-(3-chloro-2,6-difluorophenyl)-2-(hydroxymethyl)cyclopropyl]methylcarbamic acid (PubChem CID 146223658) has the molecular formula C12H12ClF2NO3 and a molecular weight of 291.68 g/mol. Its IUPAC name is [(1S,2R)-1-(3-chloro-2,6-difluorophenyl)-2-(hydroxymethyl)cyclopropyl]methylcarbamic acid.
| Compound Name | [(1S,2R)-1-(3-chloro-2,6-difluorophenyl)-2-(hydroxymethyl)cyclopropyl]methylcarbamic acid |
|---|---|
| PubChem CID | 146223658 |
| Molecular Formula | C12H12ClF2NO3 |
| Molecular Weight | 291.68 g/mol |
| Exact Mass | 291.05 |
| IUPAC Name | [(1S,2R)-1-(3-chloro-2,6-difluorophenyl)-2-(hydroxymethyl)cyclopropyl]methylcarbamic acid |
| SMILES | O=C(O)NC[C@@]1(c2c(F)ccc(Cl)c2F)C[C@H]1CO |
| InChI | InChI=1S/C12H12ClF2NO3/c13-7-1-2-8(14)9(10(7)15)12(3-6(12)4-17)5-16-11(18)19/h1-2,6,16-17H,3-5H2,(H,18,19)/t6-,12-/m0/s1 |
| InChIKey | HMBVBKCBRFGBCM-QTTZVWFDSA-N |
| XLogP | 2.14 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.68 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|