C28H39NO6 — CID 146225264
CID 146225264 (PubChem CID 146225264) has the molecular formula C28H39NO6 and a molecular weight of 485.62 g/mol.
| Compound Name | CID 146225264 |
|---|---|
| PubChem CID | 146225264 |
| Molecular Formula | C28H39NO6 |
| Molecular Weight | 485.62 g/mol |
| Exact Mass | 485.28 |
| IUPAC Name | — |
| SMILES | COC(=O)[C@@H](C)[C@H](c1ccc2c(c1)OC1(CC2O)CC2(CCN(C(=O)OC(C)(C)C)C2)C1)C1CC1 |
| InChI | InChI=1S/C28H39NO6/c1-17(24(31)33-5)23(18-6-7-18)19-8-9-20-21(30)13-28(34-22(20)12-19)14-27(15-28)10-11-29(16-27)25(32)35-26(2,3)4/h8-9,12,17-18,21,23,30H,6-7,10-11,13-16H2,1-5H3/t17-,21?,23-,27?,28?/m0/s1 |
| InChIKey | SVPJLKFYDRRHSK-CMMWSISNSA-N |
| XLogP | 4.97 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.62 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |