C23H25N7O — CID 146225441
6-(1-benzylpyrazol-4-yl)-12-methyl-8-pentyl-1,4,8,10,11-pentazatricyclo[7.3.0.03,7]dodeca-3(7),5,9,11-tetraen-2-one (PubChem CID 146225441) has the molecular formula C23H25N7O and a molecular weight of 415.50 g/mol. Its IUPAC name is 6-(1-benzylpyrazol-4-yl)-12-methyl-8-pentyl-1,4,8,10,11-pentazatricyclo[7.3.0.03,7]dodeca-3(7),5,9,11-tetraen-2-one.
| Compound Name | 6-(1-benzylpyrazol-4-yl)-12-methyl-8-pentyl-1,4,8,10,11-pentazatricyclo[7.3.0.03,7]dodeca-3(7),5,9,11-tetraen-2-one |
|---|---|
| PubChem CID | 146225441 |
| Molecular Formula | C23H25N7O |
| Molecular Weight | 415.50 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | 6-(1-benzylpyrazol-4-yl)-12-methyl-8-pentyl-1,4,8,10,11-pentazatricyclo[7.3.0.03,7]dodeca-3(7),5,9,11-tetraen-2-one |
| SMILES | CCCCCn1c2c(-c3cnn(Cc4ccccc4)c3)c[nH]c2c(=O)n2c(C)nnc12 |
| InChI | InChI=1S/C23H25N7O/c1-3-4-8-11-29-21-19(13-24-20(21)22(31)30-16(2)26-27-23(29)30)18-12-25-28(15-18)14-17-9-6-5-7-10-17/h5-7,9-10,12-13,15,24H,3-4,8,11,14H2,1-2H3 |
| InChIKey | KQRJGJJHYOKUJF-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 85.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.50 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|