C30H31F3N4O2 — CID 146225468
N-methyl-4-[2-[[5-[(Z)-4,4,4-trifluoro-1-(1H-indol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]oxy]ethylamino]butanamide (PubChem CID 146225468) has the molecular formula C30H31F3N4O2 and a molecular weight of 536.60 g/mol. Its IUPAC name is N-methyl-4-[2-[[5-[(Z)-4,4,4-trifluoro-1-(1H-indol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]oxy]ethylamino]butanamide.
| Compound Name | N-methyl-4-[2-[[5-[(Z)-4,4,4-trifluoro-1-(1H-indol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]oxy]ethylamino]butanamide |
|---|---|
| PubChem CID | 146225468 |
| Molecular Formula | C30H31F3N4O2 |
| Molecular Weight | 536.60 g/mol |
| Exact Mass | 536.24 |
| IUPAC Name | N-methyl-4-[2-[[5-[(Z)-4,4,4-trifluoro-1-(1H-indol-5-yl)-2-phenylbut-1-enyl]-2-pyridinyl]oxy]ethylamino]butanamide |
| SMILES | CNC(=O)CCCNCCOc1ccc(/C(=C(/CC(F)(F)F)c2ccccc2)c2ccc3[nH]ccc3c2)cn1 |
| InChI | InChI=1S/C30H31F3N4O2/c1-34-27(38)8-5-14-35-16-17-39-28-12-10-24(20-37-28)29(23-9-11-26-22(18-23)13-15-36-26)25(19-30(31,32)33)21-6-3-2-4-7-21/h2-4,6-7,9-13,15,18,20,35-36H,5,8,14,16-17,19H2,1H3,(H,34,38)/b29-25- |
| InChIKey | VKZZDMXRAUKHAF-GNVQSUKOSA-N |
| XLogP | 5.97 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.60 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|