About pentan-2-one;propane-1,2-diol
pentan-2-one;propane-1,2-diol (PubChem CID 146225480) has the molecular formula C8H18O3
and a molecular weight of 162.23 g/mol. Its IUPAC name is pentan-2-one;propane-1,2-diol.
Molecular Properties
| Compound Name | pentan-2-one;propane-1,2-diol |
| PubChem CID | 146225480 |
| Molecular Formula | C8H18O3 |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.13 |
| IUPAC Name | pentan-2-one;propane-1,2-diol |
| SMILES | CC(O)CO.CCCC(C)=O |
| InChI | InChI=1S/C5H10O.C3H8O2/c1-3-4-5(2)6;1-3(5)2-4/h3-4H2,1-2H3;3-5H,2H2,1H3 |
| InChIKey | GGLWPELUZIZTSC-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze pentan-2-one;propane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentan-2-one;propane-1,2-diol?
The IUPAC name of pentan-2-one;propane-1,2-diol (CID 146225480) is pentan-2-one;propane-1,2-diol.
What is the SMILES notation for pentan-2-one;propane-1,2-diol?
The canonical SMILES for pentan-2-one;propane-1,2-diol is CC(O)CO.CCCC(C)=O.
What is the InChIKey of pentan-2-one;propane-1,2-diol?
The InChIKey is GGLWPELUZIZTSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O.C3H8O2/c1-3-4-5(2)6;1-3(5)2-4/h3-4H2,1-2H3;3-5H,2H2,1H3.
What are the key properties of pentan-2-one;propane-1,2-diol?
pentan-2-one;propane-1,2-diol has a molecular weight of 162.23 g/mol, XLogP of 0.74, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pentan-2-one;propane-1,2-diol is sourced from PubChem (CID 146225480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).