C31H35ClFN5O2P+ — CID 146225654
1-[(2R,5S)-4-[6-chloro-7-(2-fluorophenyl)-2-hydroxy-2-methyl-1-(2-propan-2-ylphenyl)pyrido[2,3-d][1,3,2]diazaphosphinin-2-ium-4-yl]-2,5-dimethylpiperazin-1-yl]prop-2-en-1-one (PubChem CID 146225654) has the molecular formula C31H35ClFN5O2P+ and a molecular weight of 595.08 g/mol. Its IUPAC name is 1-[(2R,5S)-4-[6-chloro-7-(2-fluorophenyl)-2-hydroxy-2-methyl-1-(2-propan-2-ylphenyl)pyrido[2,3-d][1,3,2]diazaphosphinin-2-ium-4-yl]-2,5-dimethylpiperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(2R,5S)-4-[6-chloro-7-(2-fluorophenyl)-2-hydroxy-2-methyl-1-(2-propan-2-ylphenyl)pyrido[2,3-d][1,3,2]diazaphosphinin-2-ium-4-yl]-2,5-dimethylpiperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 146225654 |
| Molecular Formula | C31H35ClFN5O2P+ |
| Molecular Weight | 595.08 g/mol |
| Exact Mass | 594.22 |
| IUPAC Name | 1-[(2R,5S)-4-[6-chloro-7-(2-fluorophenyl)-2-hydroxy-2-methyl-1-(2-propan-2-ylphenyl)pyrido[2,3-d][1,3,2]diazaphosphinin-2-ium-4-yl]-2,5-dimethylpiperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1C[C@H](C)N(C2=N[P+](C)(O)N(c3ccccc3C(C)C)c3nc(-c4ccccc4F)c(Cl)cc32)C[C@H]1C |
| InChI | InChI=1S/C31H35ClFN5O2P/c1-7-28(39)36-17-21(5)37(18-20(36)4)31-24-16-25(32)29(23-13-8-10-14-26(23)33)34-30(24)38(41(6,40)35-31)27-15-11-9-12-22(27)19(2)3/h7-16,19-21,40H,1,17-18H2,2-6H3/q+1/t20-,21+,41?/m1/s1 |
| InChIKey | SKZWPLUNLSEIKW-WMLKNPEKSA-N |
| XLogP | 7.05 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.08 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|