C32H37ClFN5O2P+ — CID 146225656
1-[(2R,5S)-4-[6-chloro-1-(2,6-diethylphenyl)-7-(2-fluorophenyl)-2-hydroxy-2-methylpyrido[2,3-d][1,3,2]diazaphosphinin-2-ium-4-yl]-2,5-dimethylpiperazin-1-yl]prop-2-en-1-one (PubChem CID 146225656) has the molecular formula C32H37ClFN5O2P+ and a molecular weight of 609.11 g/mol. Its IUPAC name is 1-[(2R,5S)-4-[6-chloro-1-(2,6-diethylphenyl)-7-(2-fluorophenyl)-2-hydroxy-2-methylpyrido[2,3-d][1,3,2]diazaphosphinin-2-ium-4-yl]-2,5-dimethylpiperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(2R,5S)-4-[6-chloro-1-(2,6-diethylphenyl)-7-(2-fluorophenyl)-2-hydroxy-2-methylpyrido[2,3-d][1,3,2]diazaphosphinin-2-ium-4-yl]-2,5-dimethylpiperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 146225656 |
| Molecular Formula | C32H37ClFN5O2P+ |
| Molecular Weight | 609.11 g/mol |
| Exact Mass | 608.24 |
| IUPAC Name | 1-[(2R,5S)-4-[6-chloro-1-(2,6-diethylphenyl)-7-(2-fluorophenyl)-2-hydroxy-2-methylpyrido[2,3-d][1,3,2]diazaphosphinin-2-ium-4-yl]-2,5-dimethylpiperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1C[C@H](C)N(C2=N[P+](C)(O)N(c3c(CC)cccc3CC)c3nc(-c4ccccc4F)c(Cl)cc32)C[C@H]1C |
| InChI | InChI=1S/C32H37ClFN5O2P/c1-7-22-13-12-14-23(8-2)30(22)39-31-25(17-26(33)29(35-31)24-15-10-11-16-27(24)34)32(36-42(39,6)41)38-19-20(4)37(18-21(38)5)28(40)9-3/h9-17,20-21,41H,3,7-8,18-19H2,1-2,4-6H3/q+1/t20-,21+,42?/m1/s1 |
| InChIKey | HKBAOMQHJBJSOX-FKTKVYJBSA-N |
| XLogP | 7.06 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.11 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|