C19H19Cl2FN4O2 — CID 146225657
(2R,5S)-4-[2,5-dichloro-6-(2-fluorophenyl)pyridine-3-carboximidoyl]-2,5-dimethylpiperazine-1-carboxylic acid (PubChem CID 146225657) has the molecular formula C19H19Cl2FN4O2 and a molecular weight of 425.29 g/mol. Its IUPAC name is (2R,5S)-4-[2,5-dichloro-6-(2-fluorophenyl)pyridine-3-carboximidoyl]-2,5-dimethylpiperazine-1-carboxylic acid.
| Compound Name | (2R,5S)-4-[2,5-dichloro-6-(2-fluorophenyl)pyridine-3-carboximidoyl]-2,5-dimethylpiperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 146225657 |
| Molecular Formula | C19H19Cl2FN4O2 |
| Molecular Weight | 425.29 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | (2R,5S)-4-[2,5-dichloro-6-(2-fluorophenyl)pyridine-3-carboximidoyl]-2,5-dimethylpiperazine-1-carboxylic acid |
| SMILES | [H]/N=C(/c1cc(Cl)c(-c2ccccc2F)nc1Cl)N1C[C@@H](C)N(C(=O)O)C[C@@H]1C |
| InChI | InChI=1S/C19H19Cl2FN4O2/c1-10-9-26(19(27)28)11(2)8-25(10)18(23)13-7-14(20)16(24-17(13)21)12-5-3-4-6-15(12)22/h3-7,10-11,23H,8-9H2,1-2H3,(H,27,28)/b23-18-/t10-,11+/m0/s1 |
| InChIKey | LCENONOGYSEWQV-HVMHWFRRSA-N |
| XLogP | 4.59 |
| TPSA | 80.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.29 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|