C29H33ClFN5O3P+ — CID 146225659
(2R,5S)-4-[6-chloro-7-(2-fluorophenyl)-2-hydroxy-2-methyl-1-(2-propan-2-ylphenyl)pyrido[2,3-d][1,3,2]diazaphosphinin-2-ium-4-yl]-2,5-dimethylpiperazine-1-carboxylic acid (PubChem CID 146225659) has the molecular formula C29H33ClFN5O3P+ and a molecular weight of 585.04 g/mol. Its IUPAC name is (2R,5S)-4-[6-chloro-7-(2-fluorophenyl)-2-hydroxy-2-methyl-1-(2-propan-2-ylphenyl)pyrido[2,3-d][1,3,2]diazaphosphinin-2-ium-4-yl]-2,5-dimethylpiperazine-1-carboxylic acid.
| Compound Name | (2R,5S)-4-[6-chloro-7-(2-fluorophenyl)-2-hydroxy-2-methyl-1-(2-propan-2-ylphenyl)pyrido[2,3-d][1,3,2]diazaphosphinin-2-ium-4-yl]-2,5-dimethylpiperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 146225659 |
| Molecular Formula | C29H33ClFN5O3P+ |
| Molecular Weight | 585.04 g/mol |
| Exact Mass | 584.20 |
| IUPAC Name | (2R,5S)-4-[6-chloro-7-(2-fluorophenyl)-2-hydroxy-2-methyl-1-(2-propan-2-ylphenyl)pyrido[2,3-d][1,3,2]diazaphosphinin-2-ium-4-yl]-2,5-dimethylpiperazine-1-carboxylic acid |
| SMILES | CC(C)c1ccccc1N1c2nc(-c3ccccc3F)c(Cl)cc2C(N2C[C@@H](C)N(C(=O)O)C[C@@H]2C)=N[P+]1(C)O |
| InChI | InChI=1S/C29H32ClFN5O3P/c1-17(2)20-10-7-9-13-25(20)36-27-22(14-23(30)26(32-27)21-11-6-8-12-24(21)31)28(33-40(36,5)39)34-15-19(4)35(29(37)38)16-18(34)3/h6-14,17-19,39H,15-16H2,1-5H3/p+1/t18-,19+,40?/m0/s1 |
| InChIKey | TXCRNTMLCTWSCK-FDDJIHBGSA-O |
| XLogP | 7.02 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.04 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|