C25H33ClFN5O3P+ — CID 146225668
(2R,5S)-4-[6-chloro-1-(2,2-dimethylpropyl)-7-(2-fluorophenyl)-2-hydroxy-2-methylpyrido[2,3-d][1,3,2]diazaphosphinin-2-ium-4-yl]-2,5-dimethylpiperazine-1-carboxylic acid (PubChem CID 146225668) has the molecular formula C25H33ClFN5O3P+ and a molecular weight of 537.00 g/mol. Its IUPAC name is (2R,5S)-4-[6-chloro-1-(2,2-dimethylpropyl)-7-(2-fluorophenyl)-2-hydroxy-2-methylpyrido[2,3-d][1,3,2]diazaphosphinin-2-ium-4-yl]-2,5-dimethylpiperazine-1-carboxylic acid.
| Compound Name | (2R,5S)-4-[6-chloro-1-(2,2-dimethylpropyl)-7-(2-fluorophenyl)-2-hydroxy-2-methylpyrido[2,3-d][1,3,2]diazaphosphinin-2-ium-4-yl]-2,5-dimethylpiperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 146225668 |
| Molecular Formula | C25H33ClFN5O3P+ |
| Molecular Weight | 537.00 g/mol |
| Exact Mass | 536.20 |
| IUPAC Name | (2R,5S)-4-[6-chloro-1-(2,2-dimethylpropyl)-7-(2-fluorophenyl)-2-hydroxy-2-methylpyrido[2,3-d][1,3,2]diazaphosphinin-2-ium-4-yl]-2,5-dimethylpiperazine-1-carboxylic acid |
| SMILES | C[C@@H]1CN(C2=N[P+](C)(O)N(CC(C)(C)C)c3nc(-c4ccccc4F)c(Cl)cc32)[C@@H](C)CN1C(=O)O |
| InChI | InChI=1S/C25H32ClFN5O3P/c1-15-13-31(24(33)34)16(2)12-30(15)23-18-11-19(26)21(17-9-7-8-10-20(17)27)28-22(18)32(14-25(3,4)5)36(6,35)29-23/h7-11,15-16,35H,12-14H2,1-6H3/p+1/t15-,16+,36?/m0/s1 |
| InChIKey | SGDLTNULMPZKQM-HMIXCOJMSA-O |
| XLogP | 5.61 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.00 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|