C23H38N4O9PS+ — CID 146226059
[(4R)-4-[[3-(2-acetylsulfanylethylamino)-3-oxopropyl]carbamoyl]-2-hydroxy-5,5-dimethyl-1,3,2-dioxaphosphinan-2-ium-2-yl]oxymethyl 3-tert-butyl-1-methylpyrazole-5-carboxylate (PubChem CID 146226059) has the molecular formula C23H38N4O9PS+ and a molecular weight of 577.62 g/mol. Its IUPAC name is [(4R)-4-[[3-(2-acetylsulfanylethylamino)-3-oxopropyl]carbamoyl]-2-hydroxy-5,5-dimethyl-1,3,2-dioxaphosphinan-2-ium-2-yl]oxymethyl 3-tert-butyl-1-methylpyrazole-5-carboxylate.
| Compound Name | [(4R)-4-[[3-(2-acetylsulfanylethylamino)-3-oxopropyl]carbamoyl]-2-hydroxy-5,5-dimethyl-1,3,2-dioxaphosphinan-2-ium-2-yl]oxymethyl 3-tert-butyl-1-methylpyrazole-5-carboxylate |
|---|---|
| PubChem CID | 146226059 |
| Molecular Formula | C23H38N4O9PS+ |
| Molecular Weight | 577.62 g/mol |
| Exact Mass | 577.21 |
| IUPAC Name | [(4R)-4-[[3-(2-acetylsulfanylethylamino)-3-oxopropyl]carbamoyl]-2-hydroxy-5,5-dimethyl-1,3,2-dioxaphosphinan-2-ium-2-yl]oxymethyl 3-tert-butyl-1-methylpyrazole-5-carboxylate |
| SMILES | CC(=O)SCCNC(=O)CCNC(=O)[C@@H]1O[P+](O)(OCOC(=O)c2cc(C(C)(C)C)nn2C)OCC1(C)C |
| InChI | InChI=1S/C23H37N4O9PS/c1-15(28)38-11-10-24-18(29)8-9-25-20(30)19-23(5,6)13-34-37(32,36-19)35-14-33-21(31)16-12-17(22(2,3)4)26-27(16)7/h12,19,32H,8-11,13-14H2,1-7H3,(H-,24,25,29,30)/p+1/t19-,37?/m0/s1 |
| InChIKey | SQYVNNOOIHEHBU-VROGFACISA-O |
| XLogP | 1.86 |
| TPSA | 167.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.62 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|