C11H11N3O3 — CID 146226396
1-ethyl-3,5-bis(prop-2-ynyl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 146226396) has the molecular formula C11H11N3O3 and a molecular weight of 233.23 g/mol. Its IUPAC name is 1-ethyl-3,5-bis(prop-2-ynyl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-ethyl-3,5-bis(prop-2-ynyl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 146226396 |
| Molecular Formula | C11H11N3O3 |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | 1-ethyl-3,5-bis(prop-2-ynyl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | C#CCn1c(=O)n(CC)c(=O)n(CC#C)c1=O |
| InChI | InChI=1S/C11H11N3O3/c1-4-7-13-9(15)12(6-3)10(16)14(8-5-2)11(13)17/h1-2H,6-8H2,3H3 |
| InChIKey | UMHKCDWGSFHTGA-UHFFFAOYSA-N |
| XLogP | -1.54 |
| TPSA | 66.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|