About (4Z)-2-amino-4-[(Z)-prop-1-enyl]hepta-4,6-dien-1-ol
(4Z)-2-amino-4-[(Z)-prop-1-enyl]hepta-4,6-dien-1-ol (PubChem CID 146226418) has the molecular formula C10H17NO
and a molecular weight of 167.25 g/mol. Its IUPAC name is (4Z)-2-amino-4-[(Z)-prop-1-enyl]hepta-4,6-dien-1-ol.
Molecular Properties
| Compound Name | (4Z)-2-amino-4-[(Z)-prop-1-enyl]hepta-4,6-dien-1-ol |
| PubChem CID | 146226418 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | (4Z)-2-amino-4-[(Z)-prop-1-enyl]hepta-4,6-dien-1-ol |
| SMILES | C=C/C=C(\C=C/C)CC(N)CO |
| InChI | InChI=1S/C10H17NO/c1-3-5-9(6-4-2)7-10(11)8-12/h3-6,10,12H,1,7-8,11H2,2H3/b6-4-,9-5+ |
| InChIKey | DDMMWRJVXYUWEG-QUNSIMLLSA-N |
| XLogP | 1.38 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (4Z)-2-amino-4-[(Z)-prop-1-enyl]hepta-4,6-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-2-amino-4-[(Z)-prop-1-enyl]hepta-4,6-dien-1-ol?
The IUPAC name of (4Z)-2-amino-4-[(Z)-prop-1-enyl]hepta-4,6-dien-1-ol (CID 146226418) is (4Z)-2-amino-4-[(Z)-prop-1-enyl]hepta-4,6-dien-1-ol.
What is the SMILES notation for (4Z)-2-amino-4-[(Z)-prop-1-enyl]hepta-4,6-dien-1-ol?
The canonical SMILES for (4Z)-2-amino-4-[(Z)-prop-1-enyl]hepta-4,6-dien-1-ol is C=C/C=C(\C=C/C)CC(N)CO.
What is the InChIKey of (4Z)-2-amino-4-[(Z)-prop-1-enyl]hepta-4,6-dien-1-ol?
The InChIKey is DDMMWRJVXYUWEG-QUNSIMLLSA-N. The full InChI is InChI=1S/C10H17NO/c1-3-5-9(6-4-2)7-10(11)8-12/h3-6,10,12H,1,7-8,11H2,2H3/b6-4-,9-5+.
What are the key properties of (4Z)-2-amino-4-[(Z)-prop-1-enyl]hepta-4,6-dien-1-ol?
(4Z)-2-amino-4-[(Z)-prop-1-enyl]hepta-4,6-dien-1-ol has a molecular weight of 167.25 g/mol, XLogP of 1.38, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-2-amino-4-[(Z)-prop-1-enyl]hepta-4,6-dien-1-ol is sourced from PubChem (CID 146226418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).