C13H23NO — CID 146226419
(2R,4Z,6Z)-2-amino-4-[(Z)-3-methylbut-1-enyl]octa-4,6-dien-1-ol (PubChem CID 146226419) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is (2R,4Z,6Z)-2-amino-4-[(Z)-3-methylbut-1-enyl]octa-4,6-dien-1-ol.
| Compound Name | (2R,4Z,6Z)-2-amino-4-[(Z)-3-methylbut-1-enyl]octa-4,6-dien-1-ol |
|---|---|
| PubChem CID | 146226419 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | (2R,4Z,6Z)-2-amino-4-[(Z)-3-methylbut-1-enyl]octa-4,6-dien-1-ol |
| SMILES | C/C=C\C=C(/C=C\C(C)C)C[C@@H](N)CO |
| InChI | InChI=1S/C13H23NO/c1-4-5-6-12(8-7-11(2)3)9-13(14)10-15/h4-8,11,13,15H,9-10,14H2,1-3H3/b5-4-,8-7-,12-6+/t13-/m1/s1 |
| InChIKey | GOZWERNRFZDVMF-SISDOODFSA-N |
| XLogP | 2.41 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|