C24H35N5O3 — CID 146226501
1-[(2S)-6-(3,4-dimethyl-2,3a,5,6,7,7a-hexahydro-1H-imidazo[4,5-b]pyridin-5-yl)-2-methyl-4-(oxolane-2-carbonyl)-2,3-dihydroquinoxalin-1-yl]ethanone (PubChem CID 146226501) has the molecular formula C24H35N5O3 and a molecular weight of 441.58 g/mol. Its IUPAC name is 1-[(2S)-6-(3,4-dimethyl-2,3a,5,6,7,7a-hexahydro-1H-imidazo[4,5-b]pyridin-5-yl)-2-methyl-4-(oxolane-2-carbonyl)-2,3-dihydroquinoxalin-1-yl]ethanone.
| Compound Name | 1-[(2S)-6-(3,4-dimethyl-2,3a,5,6,7,7a-hexahydro-1H-imidazo[4,5-b]pyridin-5-yl)-2-methyl-4-(oxolane-2-carbonyl)-2,3-dihydroquinoxalin-1-yl]ethanone |
|---|---|
| PubChem CID | 146226501 |
| Molecular Formula | C24H35N5O3 |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.27 |
| IUPAC Name | 1-[(2S)-6-(3,4-dimethyl-2,3a,5,6,7,7a-hexahydro-1H-imidazo[4,5-b]pyridin-5-yl)-2-methyl-4-(oxolane-2-carbonyl)-2,3-dihydroquinoxalin-1-yl]ethanone |
| SMILES | CC(=O)N1c2ccc(C3CCC4NCN(C)C4N3C)cc2N(C(=O)C2CCCO2)C[C@@H]1C |
| InChI | InChI=1S/C24H35N5O3/c1-15-13-28(24(31)22-6-5-11-32-22)21-12-17(7-9-20(21)29(15)16(2)30)19-10-8-18-23(27(19)4)26(3)14-25-18/h7,9,12,15,18-19,22-23,25H,5-6,8,10-11,13-14H2,1-4H3/t15-,18?,19?,22?,23?/m0/s1 |
| InChIKey | UHPDBOJRUGWVOM-BTEDFZBLSA-N |
| XLogP | 1.91 |
| TPSA | 68.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |