C14H23F2N3 — CID 146227790
N'-(3-aminoprop-1-en-2-yl)-N-[(2E,4E)-2-ethyl-4,6-difluorohepta-2,4-dienyl]-N-methylmethanimidamide (PubChem CID 146227790) has the molecular formula C14H23F2N3 and a molecular weight of 271.36 g/mol. Its IUPAC name is N'-(3-aminoprop-1-en-2-yl)-N-[(2E,4E)-2-ethyl-4,6-difluorohepta-2,4-dienyl]-N-methylmethanimidamide.
| Compound Name | N'-(3-aminoprop-1-en-2-yl)-N-[(2E,4E)-2-ethyl-4,6-difluorohepta-2,4-dienyl]-N-methylmethanimidamide |
|---|---|
| PubChem CID | 146227790 |
| Molecular Formula | C14H23F2N3 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | N'-(3-aminoprop-1-en-2-yl)-N-[(2E,4E)-2-ethyl-4,6-difluorohepta-2,4-dienyl]-N-methylmethanimidamide |
| SMILES | C=C(CN)/N=C/N(C)C/C(=C/C(F)=C\C(C)F)CC |
| InChI | InChI=1S/C14H23F2N3/c1-5-13(7-14(16)6-11(2)15)9-19(4)10-18-12(3)8-17/h6-7,10-11H,3,5,8-9,17H2,1-2,4H3/b13-7+,14-6+,18-10+ |
| InChIKey | ORXVMQRAWHAHMP-RWTAAGDXSA-N |
| XLogP | 2.97 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|