C29H32N4O2S2 — CID 146227869
N-(5-methyl-1,3-thiazol-2-yl)-5-[2-[3-[4-[(5-methyl-1,3-thiazol-2-yl)amino]-4-oxobutyl]phenyl]phenyl]pentanamide (PubChem CID 146227869) has the molecular formula C29H32N4O2S2 and a molecular weight of 532.74 g/mol. Its IUPAC name is N-(5-methyl-1,3-thiazol-2-yl)-5-[2-[3-[4-[(5-methyl-1,3-thiazol-2-yl)amino]-4-oxobutyl]phenyl]phenyl]pentanamide.
| Compound Name | N-(5-methyl-1,3-thiazol-2-yl)-5-[2-[3-[4-[(5-methyl-1,3-thiazol-2-yl)amino]-4-oxobutyl]phenyl]phenyl]pentanamide |
|---|---|
| PubChem CID | 146227869 |
| Molecular Formula | C29H32N4O2S2 |
| Molecular Weight | 532.74 g/mol |
| Exact Mass | 532.20 |
| IUPAC Name | N-(5-methyl-1,3-thiazol-2-yl)-5-[2-[3-[4-[(5-methyl-1,3-thiazol-2-yl)amino]-4-oxobutyl]phenyl]phenyl]pentanamide |
| SMILES | Cc1cnc(NC(=O)CCCCc2ccccc2-c2cccc(CCCC(=O)Nc3ncc(C)s3)c2)s1 |
| InChI | InChI=1S/C29H32N4O2S2/c1-20-18-30-28(36-20)32-26(34)15-6-4-12-23-11-3-5-14-25(23)24-13-7-9-22(17-24)10-8-16-27(35)33-29-31-19-21(2)37-29/h3,5,7,9,11,13-14,17-19H,4,6,8,10,12,15-16H2,1-2H3,(H,30,32,34)(H,31,33,35) |
| InChIKey | PWDLZOPXLIFVJA-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.74 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|