About (4S)-7-chloro-8-(cyclopropylmethoxy)-4-ethyl-4-propan-2-yl-2,3-dihydrochromene
(4S)-7-chloro-8-(cyclopropylmethoxy)-4-ethyl-4-propan-2-yl-2,3-dihydrochromene (PubChem CID 146228241) has the molecular formula C18H25ClO2
and a molecular weight of 308.85 g/mol. Its IUPAC name is (4S)-7-chloro-8-(cyclopropylmethoxy)-4-ethyl-4-propan-2-yl-2,3-dihydrochromene.
Molecular Properties
| Compound Name | (4S)-7-chloro-8-(cyclopropylmethoxy)-4-ethyl-4-propan-2-yl-2,3-dihydrochromene |
| PubChem CID | 146228241 |
| Molecular Formula | C18H25ClO2 |
| Molecular Weight | 308.85 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | (4S)-7-chloro-8-(cyclopropylmethoxy)-4-ethyl-4-propan-2-yl-2,3-dihydrochromene |
| SMILES | CC[C@@]1(C(C)C)CCOc2c1ccc(Cl)c2OCC1CC1 |
| InChI | InChI=1S/C18H25ClO2/c1-4-18(12(2)3)9-10-20-16-14(18)7-8-15(19)17(16)21-11-13-5-6-13/h7-8,12-13H,4-6,9-11H2,1-3H3/t18-/m0/s1 |
| InChIKey | GYCTXOPIUAJUKX-SFHVURJKSA-N |
| XLogP | 5.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 308.85 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4S)-7-chloro-8-(cyclopropylmethoxy)-4-ethyl-4-propan-2-yl-2,3-dihydrochromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-7-chloro-8-(cyclopropylmethoxy)-4-ethyl-4-propan-2-yl-2,3-dihydrochromene?
The IUPAC name of (4S)-7-chloro-8-(cyclopropylmethoxy)-4-ethyl-4-propan-2-yl-2,3-dihydrochromene (CID 146228241) is (4S)-7-chloro-8-(cyclopropylmethoxy)-4-ethyl-4-propan-2-yl-2,3-dihydrochromene.
What is the SMILES notation for (4S)-7-chloro-8-(cyclopropylmethoxy)-4-ethyl-4-propan-2-yl-2,3-dihydrochromene?
The canonical SMILES for (4S)-7-chloro-8-(cyclopropylmethoxy)-4-ethyl-4-propan-2-yl-2,3-dihydrochromene is CC[C@@]1(C(C)C)CCOc2c1ccc(Cl)c2OCC1CC1.
What is the InChIKey of (4S)-7-chloro-8-(cyclopropylmethoxy)-4-ethyl-4-propan-2-yl-2,3-dihydrochromene?
The InChIKey is GYCTXOPIUAJUKX-SFHVURJKSA-N. The full InChI is InChI=1S/C18H25ClO2/c1-4-18(12(2)3)9-10-20-16-14(18)7-8-15(19)17(16)21-11-13-5-6-13/h7-8,12-13H,4-6,9-11H2,1-3H3/t18-/m0/s1.
What are the key properties of (4S)-7-chloro-8-(cyclopropylmethoxy)-4-ethyl-4-propan-2-yl-2,3-dihydrochromene?
(4S)-7-chloro-8-(cyclopropylmethoxy)-4-ethyl-4-propan-2-yl-2,3-dihydrochromene has a molecular weight of 308.85 g/mol, XLogP of 5.22, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-7-chloro-8-(cyclopropylmethoxy)-4-ethyl-4-propan-2-yl-2,3-dihydrochromene is sourced from PubChem (CID 146228241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).