C21H24N4O2S — CID 146228430
7-[(3S,5R)-3,5-dimethylpiperazin-1-yl]-3-(3-methylimidazo[2,1-b][1,3]thiazol-6-yl)-2H-chromen-2-ol (PubChem CID 146228430) has the molecular formula C21H24N4O2S and a molecular weight of 396.52 g/mol. Its IUPAC name is 7-[(3S,5R)-3,5-dimethylpiperazin-1-yl]-3-(3-methylimidazo[2,1-b][1,3]thiazol-6-yl)-2H-chromen-2-ol.
| Compound Name | 7-[(3S,5R)-3,5-dimethylpiperazin-1-yl]-3-(3-methylimidazo[2,1-b][1,3]thiazol-6-yl)-2H-chromen-2-ol |
|---|---|
| PubChem CID | 146228430 |
| Molecular Formula | C21H24N4O2S |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | 7-[(3S,5R)-3,5-dimethylpiperazin-1-yl]-3-(3-methylimidazo[2,1-b][1,3]thiazol-6-yl)-2H-chromen-2-ol |
| SMILES | Cc1csc2nc(C3=Cc4ccc(N5C[C@@H](C)N[C@@H](C)C5)cc4OC3O)cn12 |
| InChI | InChI=1S/C21H24N4O2S/c1-12-8-24(9-13(2)22-12)16-5-4-15-6-17(20(26)27-19(15)7-16)18-10-25-14(3)11-28-21(25)23-18/h4-7,10-13,20,22,26H,8-9H2,1-3H3/t12-,13+,20? |
| InChIKey | PTWCGMIKOCYYRP-QNBIARANSA-N |
| XLogP | 3.14 |
| TPSA | 62.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|