C25H27FN4O2 — CID 146228527
7-(6,9-diazaspiro[4.5]decan-9-yl)-3-(8-fluoro-6-methylimidazo[1,2-a]pyridin-2-yl)-2H-chromen-2-ol (PubChem CID 146228527) has the molecular formula C25H27FN4O2 and a molecular weight of 434.52 g/mol. Its IUPAC name is 7-(6,9-diazaspiro[4.5]decan-9-yl)-3-(8-fluoro-6-methylimidazo[1,2-a]pyridin-2-yl)-2H-chromen-2-ol.
| Compound Name | 7-(6,9-diazaspiro[4.5]decan-9-yl)-3-(8-fluoro-6-methylimidazo[1,2-a]pyridin-2-yl)-2H-chromen-2-ol |
|---|---|
| PubChem CID | 146228527 |
| Molecular Formula | C25H27FN4O2 |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | 7-(6,9-diazaspiro[4.5]decan-9-yl)-3-(8-fluoro-6-methylimidazo[1,2-a]pyridin-2-yl)-2H-chromen-2-ol |
| SMILES | Cc1cc(F)c2nc(C3=Cc4ccc(N5CCNC6(CCCC6)C5)cc4OC3O)cn2c1 |
| InChI | InChI=1S/C25H27FN4O2/c1-16-10-20(26)23-28-21(14-30(23)13-16)19-11-17-4-5-18(12-22(17)32-24(19)31)29-9-8-27-25(15-29)6-2-3-7-25/h4-5,10-14,24,27,31H,2-3,6-9,15H2,1H3 |
| InChIKey | OUIZXXDLNBSTCB-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 62.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'} |
|---|