C26H39N — CID 146228669
N-(cyclopropylmethyl)-4-[(2E)-2,3-dimethylpenta-2,4-dienyl]-4-ethyl-3,5,6-trimethyl-2,3-dihydro-1H-naphthalen-2-amine (PubChem CID 146228669) has the molecular formula C26H39N and a molecular weight of 365.61 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-4-[(2E)-2,3-dimethylpenta-2,4-dienyl]-4-ethyl-3,5,6-trimethyl-2,3-dihydro-1H-naphthalen-2-amine.
| Compound Name | N-(cyclopropylmethyl)-4-[(2E)-2,3-dimethylpenta-2,4-dienyl]-4-ethyl-3,5,6-trimethyl-2,3-dihydro-1H-naphthalen-2-amine |
|---|---|
| PubChem CID | 146228669 |
| Molecular Formula | C26H39N |
| Molecular Weight | 365.61 g/mol |
| Exact Mass | 365.31 |
| IUPAC Name | N-(cyclopropylmethyl)-4-[(2E)-2,3-dimethylpenta-2,4-dienyl]-4-ethyl-3,5,6-trimethyl-2,3-dihydro-1H-naphthalen-2-amine |
| SMILES | C=C/C(C)=C(\C)CC1(CC)c2c(ccc(C)c2C)CC(NCC2CC2)C1C |
| InChI | InChI=1S/C26H39N/c1-8-17(3)19(5)15-26(9-2)21(7)24(27-16-22-11-12-22)14-23-13-10-18(4)20(6)25(23)26/h8,10,13,21-22,24,27H,1,9,11-12,14-16H2,2-7H3/b19-17+ |
| InChIKey | KWLVYLOWIKXRTB-HTXNQAPBSA-N |
| XLogP | 6.42 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.61 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|