C16H17ClFN3O3S2 — CID 14622872
ethyl 2-[2-chloro-4-fluoro-5-[(3-oxo-5,6,7,8-tetrahydro-[1,3,4]thiadiazolo[3,4-a]pyridazin-1-ylidene)amino]phenyl]sulfanylacetate (PubChem CID 14622872) has the molecular formula C16H17ClFN3O3S2 and a molecular weight of 417.92 g/mol. Its IUPAC name is ethyl 2-[2-chloro-4-fluoro-5-[(3-oxo-5,6,7,8-tetrahydro-[1,3,4]thiadiazolo[3,4-a]pyridazin-1-ylidene)amino]phenyl]sulfanylacetate.
| Compound Name | ethyl 2-[2-chloro-4-fluoro-5-[(3-oxo-5,6,7,8-tetrahydro-[1,3,4]thiadiazolo[3,4-a]pyridazin-1-ylidene)amino]phenyl]sulfanylacetate |
|---|---|
| PubChem CID | 14622872 |
| Molecular Formula | C16H17ClFN3O3S2 |
| Molecular Weight | 417.92 g/mol |
| Exact Mass | 417.04 |
| IUPAC Name | ethyl 2-[2-chloro-4-fluoro-5-[(3-oxo-5,6,7,8-tetrahydro-[1,3,4]thiadiazolo[3,4-a]pyridazin-1-ylidene)amino]phenyl]sulfanylacetate |
| SMILES | CCOC(=O)CSc1cc(/N=c2\sc(=O)n3n2CCCC3)c(F)cc1Cl |
| InChI | InChI=1S/C16H17ClFN3O3S2/c1-2-24-14(22)9-25-13-8-12(11(18)7-10(13)17)19-15-20-5-3-4-6-21(20)16(23)26-15/h7-8H,2-6,9H2,1H3/b19-15- |
| InChIKey | LYMMTHACEMSWDE-CYVLTUHYSA-N |
| XLogP | 3.19 |
| TPSA | 65.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.92 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |