C15H31F2NO — CID 146228722
N-butyl-5,5-difluoro-6-methoxy-4,7-dimethyloctan-1-amine (PubChem CID 146228722) has the molecular formula C15H31F2NO and a molecular weight of 279.41 g/mol. Its IUPAC name is N-butyl-5,5-difluoro-6-methoxy-4,7-dimethyloctan-1-amine.
| Compound Name | N-butyl-5,5-difluoro-6-methoxy-4,7-dimethyloctan-1-amine |
|---|---|
| PubChem CID | 146228722 |
| Molecular Formula | C15H31F2NO |
| Molecular Weight | 279.41 g/mol |
| Exact Mass | 279.24 |
| IUPAC Name | N-butyl-5,5-difluoro-6-methoxy-4,7-dimethyloctan-1-amine |
| SMILES | CCCCNCCCC(C)C(F)(F)C(OC)C(C)C |
| InChI | InChI=1S/C15H31F2NO/c1-6-7-10-18-11-8-9-13(4)15(16,17)14(19-5)12(2)3/h12-14,18H,6-11H2,1-5H3 |
| InChIKey | VLMVFWMFCSZUHD-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.41 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|