C18H21ClFN3O4S2 — CID 14622873
2-methoxyethyl 2-[2-chloro-4-fluoro-5-[(3-oxo-5,6,7,8-tetrahydro-[1,3,4]thiadiazolo[3,4-a]pyridazin-1-ylidene)amino]phenyl]sulfanylpropanoate (PubChem CID 14622873) has the molecular formula C18H21ClFN3O4S2 and a molecular weight of 461.97 g/mol. Its IUPAC name is 2-methoxyethyl 2-[2-chloro-4-fluoro-5-[(3-oxo-5,6,7,8-tetrahydro-[1,3,4]thiadiazolo[3,4-a]pyridazin-1-ylidene)amino]phenyl]sulfanylpropanoate.
| Compound Name | 2-methoxyethyl 2-[2-chloro-4-fluoro-5-[(3-oxo-5,6,7,8-tetrahydro-[1,3,4]thiadiazolo[3,4-a]pyridazin-1-ylidene)amino]phenyl]sulfanylpropanoate |
|---|---|
| PubChem CID | 14622873 |
| Molecular Formula | C18H21ClFN3O4S2 |
| Molecular Weight | 461.97 g/mol |
| Exact Mass | 461.06 |
| IUPAC Name | 2-methoxyethyl 2-[2-chloro-4-fluoro-5-[(3-oxo-5,6,7,8-tetrahydro-[1,3,4]thiadiazolo[3,4-a]pyridazin-1-ylidene)amino]phenyl]sulfanylpropanoate |
| SMILES | COCCOC(=O)C(C)Sc1cc(/N=c2\sc(=O)n3n2CCCC3)c(F)cc1Cl |
| InChI | InChI=1S/C18H21ClFN3O4S2/c1-11(16(24)27-8-7-26-2)28-15-10-14(13(20)9-12(15)19)21-17-22-5-3-4-6-23(22)18(25)29-17/h9-11H,3-8H2,1-2H3/b21-17- |
| InChIKey | GOQHVXUTAWLYQA-FXBPSFAMSA-N |
| XLogP | 3.20 |
| TPSA | 74.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.97 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|