About [4-(disulfanylmethyl)-1,3-thiazol-2-yl]methanimine
[4-(disulfanylmethyl)-1,3-thiazol-2-yl]methanimine (PubChem CID 146228837) has the molecular formula C5H6N2S3
and a molecular weight of 190.32 g/mol. Its IUPAC name is [4-(disulfanylmethyl)-1,3-thiazol-2-yl]methanimine.
Molecular Properties
| Compound Name | [4-(disulfanylmethyl)-1,3-thiazol-2-yl]methanimine |
| PubChem CID | 146228837 |
| Molecular Formula | C5H6N2S3 |
| Molecular Weight | 190.32 g/mol |
| Exact Mass | 189.97 |
| IUPAC Name | [4-(disulfanylmethyl)-1,3-thiazol-2-yl]methanimine |
| SMILES | [H]/N=C/c1nc(CSS)cs1 |
| InChI | InChI=1S/C5H6N2S3/c6-1-5-7-4(2-9-5)3-10-8/h1-2,6,8H,3H2/b6-1+ |
| InChIKey | HURKHYXIBVYMRE-LZCJLJQNSA-N |
| XLogP | 2.22 |
| TPSA | 36.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.32 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze [4-(disulfanylmethyl)-1,3-thiazol-2-yl]methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(disulfanylmethyl)-1,3-thiazol-2-yl]methanimine?
The IUPAC name of [4-(disulfanylmethyl)-1,3-thiazol-2-yl]methanimine (CID 146228837) is [4-(disulfanylmethyl)-1,3-thiazol-2-yl]methanimine.
What is the SMILES notation for [4-(disulfanylmethyl)-1,3-thiazol-2-yl]methanimine?
The canonical SMILES for [4-(disulfanylmethyl)-1,3-thiazol-2-yl]methanimine is [H]/N=C/c1nc(CSS)cs1.
What is the InChIKey of [4-(disulfanylmethyl)-1,3-thiazol-2-yl]methanimine?
The InChIKey is HURKHYXIBVYMRE-LZCJLJQNSA-N. The full InChI is InChI=1S/C5H6N2S3/c6-1-5-7-4(2-9-5)3-10-8/h1-2,6,8H,3H2/b6-1+.
What are the key properties of [4-(disulfanylmethyl)-1,3-thiazol-2-yl]methanimine?
[4-(disulfanylmethyl)-1,3-thiazol-2-yl]methanimine has a molecular weight of 190.32 g/mol, XLogP of 2.22, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(disulfanylmethyl)-1,3-thiazol-2-yl]methanimine is sourced from PubChem (CID 146228837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).