C30H45N3 — CID 146228886
5-[6-[4-[2-[1-(2,2-dimethylpropyl)piperidin-4-yl]ethyl]phenyl]-3-pyridinyl]-N-ethenylpentan-1-amine (PubChem CID 146228886) has the molecular formula C30H45N3 and a molecular weight of 447.71 g/mol. Its IUPAC name is 5-[6-[4-[2-[1-(2,2-dimethylpropyl)piperidin-4-yl]ethyl]phenyl]-3-pyridinyl]-N-ethenylpentan-1-amine.
| Compound Name | 5-[6-[4-[2-[1-(2,2-dimethylpropyl)piperidin-4-yl]ethyl]phenyl]-3-pyridinyl]-N-ethenylpentan-1-amine |
|---|---|
| PubChem CID | 146228886 |
| Molecular Formula | C30H45N3 |
| Molecular Weight | 447.71 g/mol |
| Exact Mass | 447.36 |
| IUPAC Name | 5-[6-[4-[2-[1-(2,2-dimethylpropyl)piperidin-4-yl]ethyl]phenyl]-3-pyridinyl]-N-ethenylpentan-1-amine |
| SMILES | C=CNCCCCCc1ccc(-c2ccc(CCC3CCN(CC(C)(C)C)CC3)cc2)nc1 |
| InChI | InChI=1S/C30H45N3/c1-5-31-20-8-6-7-9-27-14-17-29(32-23-27)28-15-12-25(13-16-28)10-11-26-18-21-33(22-19-26)24-30(2,3)4/h5,12-17,23,26,31H,1,6-11,18-22,24H2,2-4H3 |
| InChIKey | BNGFEDMAVFDHLO-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.71 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|