C18H21ClFN3O3S2 — CID 14622905
butyl 2-[2-chloro-4-fluoro-5-[(3-oxo-5,6,7,8-tetrahydro-[1,3,4]thiadiazolo[3,4-a]pyridazin-1-ylidene)amino]phenyl]sulfanylacetate (PubChem CID 14622905) has the molecular formula C18H21ClFN3O3S2 and a molecular weight of 445.97 g/mol. Its IUPAC name is butyl 2-[2-chloro-4-fluoro-5-[(3-oxo-5,6,7,8-tetrahydro-[1,3,4]thiadiazolo[3,4-a]pyridazin-1-ylidene)amino]phenyl]sulfanylacetate.
| Compound Name | butyl 2-[2-chloro-4-fluoro-5-[(3-oxo-5,6,7,8-tetrahydro-[1,3,4]thiadiazolo[3,4-a]pyridazin-1-ylidene)amino]phenyl]sulfanylacetate |
|---|---|
| PubChem CID | 14622905 |
| Molecular Formula | C18H21ClFN3O3S2 |
| Molecular Weight | 445.97 g/mol |
| Exact Mass | 445.07 |
| IUPAC Name | butyl 2-[2-chloro-4-fluoro-5-[(3-oxo-5,6,7,8-tetrahydro-[1,3,4]thiadiazolo[3,4-a]pyridazin-1-ylidene)amino]phenyl]sulfanylacetate |
| SMILES | CCCCOC(=O)CSc1cc(/N=c2\sc(=O)n3n2CCCC3)c(F)cc1Cl |
| InChI | InChI=1S/C18H21ClFN3O3S2/c1-2-3-8-26-16(24)11-27-15-10-14(13(20)9-12(15)19)21-17-22-6-4-5-7-23(22)18(25)28-17/h9-10H,2-8,11H2,1H3/b21-17- |
| InChIKey | LXBFMVHXBISQTP-FXBPSFAMSA-N |
| XLogP | 3.97 |
| TPSA | 65.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.97 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|