C19H23ClFN3O3S2 — CID 14622920
pentyl 2-[2-chloro-4-fluoro-5-[(3-oxo-5,6,7,8-tetrahydro-[1,3,4]thiadiazolo[3,4-a]pyridazin-1-ylidene)amino]phenyl]sulfanylacetate (PubChem CID 14622920) has the molecular formula C19H23ClFN3O3S2 and a molecular weight of 460.00 g/mol. Its IUPAC name is pentyl 2-[2-chloro-4-fluoro-5-[(3-oxo-5,6,7,8-tetrahydro-[1,3,4]thiadiazolo[3,4-a]pyridazin-1-ylidene)amino]phenyl]sulfanylacetate.
| Compound Name | pentyl 2-[2-chloro-4-fluoro-5-[(3-oxo-5,6,7,8-tetrahydro-[1,3,4]thiadiazolo[3,4-a]pyridazin-1-ylidene)amino]phenyl]sulfanylacetate |
|---|---|
| PubChem CID | 14622920 |
| Molecular Formula | C19H23ClFN3O3S2 |
| Molecular Weight | 460.00 g/mol |
| Exact Mass | 459.09 |
| IUPAC Name | pentyl 2-[2-chloro-4-fluoro-5-[(3-oxo-5,6,7,8-tetrahydro-[1,3,4]thiadiazolo[3,4-a]pyridazin-1-ylidene)amino]phenyl]sulfanylacetate |
| SMILES | CCCCCOC(=O)CSc1cc(/N=c2\sc(=O)n3n2CCCC3)c(F)cc1Cl |
| InChI | InChI=1S/C19H23ClFN3O3S2/c1-2-3-6-9-27-17(25)12-28-16-11-15(14(21)10-13(16)20)22-18-23-7-4-5-8-24(23)19(26)29-18/h10-11H,2-9,12H2,1H3/b22-18- |
| InChIKey | AYVNCROPPUNYDE-PYCFMQQDSA-N |
| XLogP | 4.36 |
| TPSA | 65.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.00 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|