C11H17BrN2S — CID 146229382
N-[(5-bromo-3-pyridinyl)methyl]-N-ethylsulfanylpropan-2-amine (PubChem CID 146229382) has the molecular formula C11H17BrN2S and a molecular weight of 289.24 g/mol. Its IUPAC name is N-[(5-bromo-3-pyridinyl)methyl]-N-ethylsulfanylpropan-2-amine.
| Compound Name | N-[(5-bromo-3-pyridinyl)methyl]-N-ethylsulfanylpropan-2-amine |
|---|---|
| PubChem CID | 146229382 |
| Molecular Formula | C11H17BrN2S |
| Molecular Weight | 289.24 g/mol |
| Exact Mass | 288.03 |
| IUPAC Name | N-[(5-bromo-3-pyridinyl)methyl]-N-ethylsulfanylpropan-2-amine |
| SMILES | CCSN(Cc1cncc(Br)c1)C(C)C |
| InChI | InChI=1S/C11H17BrN2S/c1-4-15-14(9(2)3)8-10-5-11(12)7-13-6-10/h5-7,9H,4,8H2,1-3H3 |
| InChIKey | ABXOQHKUTGPBQX-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.24 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|