C26H34N8O — CID 146229660
1-[4-methanimidoyl-5-[(2-methyl-4-pyridinyl)amino]-2-pyridinyl]-3-[2-[1-(N-methylanilino)butan-2-ylamino]ethyl]urea (PubChem CID 146229660) has the molecular formula C26H34N8O and a molecular weight of 474.61 g/mol. Its IUPAC name is 1-[4-methanimidoyl-5-[(2-methyl-4-pyridinyl)amino]-2-pyridinyl]-3-[2-[1-(N-methylanilino)butan-2-ylamino]ethyl]urea.
| Compound Name | 1-[4-methanimidoyl-5-[(2-methyl-4-pyridinyl)amino]-2-pyridinyl]-3-[2-[1-(N-methylanilino)butan-2-ylamino]ethyl]urea |
|---|---|
| PubChem CID | 146229660 |
| Molecular Formula | C26H34N8O |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.29 |
| IUPAC Name | 1-[4-methanimidoyl-5-[(2-methyl-4-pyridinyl)amino]-2-pyridinyl]-3-[2-[1-(N-methylanilino)butan-2-ylamino]ethyl]urea |
| SMILES | [H]/N=C/c1cc(NC(=O)NCCNC(CC)CN(C)c2ccccc2)ncc1Nc1ccnc(C)c1 |
| InChI | InChI=1S/C26H34N8O/c1-4-21(18-34(3)23-8-6-5-7-9-23)29-12-13-30-26(35)33-25-15-20(16-27)24(17-31-25)32-22-10-11-28-19(2)14-22/h5-11,14-17,21,27,29H,4,12-13,18H2,1-3H3,(H,28,32)(H2,30,31,33,35)/b27-16+ |
| InChIKey | ZIZBOCZDNXKONU-JVWAILMASA-N |
| XLogP | 4.15 |
| TPSA | 118.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|