C26H44N2S2 — CID 146230344
2-(2,2-dimethylpropyl)-5-[6-[2-(2,2-dimethylpropyl)-1,3-thiazol-5-yl]-2,2,5,5-tetramethylhexyl]-1,3-thiazole (PubChem CID 146230344) has the molecular formula C26H44N2S2 and a molecular weight of 448.79 g/mol. Its IUPAC name is 2-(2,2-dimethylpropyl)-5-[6-[2-(2,2-dimethylpropyl)-1,3-thiazol-5-yl]-2,2,5,5-tetramethylhexyl]-1,3-thiazole.
| Compound Name | 2-(2,2-dimethylpropyl)-5-[6-[2-(2,2-dimethylpropyl)-1,3-thiazol-5-yl]-2,2,5,5-tetramethylhexyl]-1,3-thiazole |
|---|---|
| PubChem CID | 146230344 |
| Molecular Formula | C26H44N2S2 |
| Molecular Weight | 448.79 g/mol |
| Exact Mass | 448.29 |
| IUPAC Name | 2-(2,2-dimethylpropyl)-5-[6-[2-(2,2-dimethylpropyl)-1,3-thiazol-5-yl]-2,2,5,5-tetramethylhexyl]-1,3-thiazole |
| SMILES | CC(C)(C)Cc1ncc(CC(C)(C)CCC(C)(C)Cc2cnc(CC(C)(C)C)s2)s1 |
| InChI | InChI=1S/C26H44N2S2/c1-23(2,3)15-21-27-17-19(29-21)13-25(7,8)11-12-26(9,10)14-20-18-28-22(30-20)16-24(4,5)6/h17-18H,11-16H2,1-10H3 |
| InChIKey | KWRAFTQNMZMKKO-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.79 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |