C12H16F3N — CID 146230452
5-(2,3-dimethylbutan-2-yl)-2-(trifluoromethyl)pyridine (PubChem CID 146230452) has the molecular formula C12H16F3N and a molecular weight of 231.26 g/mol. Its IUPAC name is 5-(2,3-dimethylbutan-2-yl)-2-(trifluoromethyl)pyridine.
| Compound Name | 5-(2,3-dimethylbutan-2-yl)-2-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 146230452 |
| Molecular Formula | C12H16F3N |
| Molecular Weight | 231.26 g/mol |
| Exact Mass | 231.12 |
| IUPAC Name | 5-(2,3-dimethylbutan-2-yl)-2-(trifluoromethyl)pyridine |
| SMILES | CC(C)C(C)(C)c1ccc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C12H16F3N/c1-8(2)11(3,4)9-5-6-10(16-7-9)12(13,14)15/h5-8H,1-4H3 |
| InChIKey | QVYQVMQREPFRLI-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.26 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |