C64H38N8 — CID 146230593
2-naphthalen-1-yl-4-[6-[4-naphthalen-1-yl-6-(3-pyridin-4-ylphenyl)-1,3,5-triazin-2-yl]pyren-1-yl]-6-(3-pyridin-4-ylphenyl)-1,3,5-triazine (PubChem CID 146230593) has the molecular formula C64H38N8 and a molecular weight of 919.06 g/mol. Its IUPAC name is 2-naphthalen-1-yl-4-[6-[4-naphthalen-1-yl-6-(3-pyridin-4-ylphenyl)-1,3,5-triazin-2-yl]pyren-1-yl]-6-(3-pyridin-4-ylphenyl)-1,3,5-triazine.
| Compound Name | 2-naphthalen-1-yl-4-[6-[4-naphthalen-1-yl-6-(3-pyridin-4-ylphenyl)-1,3,5-triazin-2-yl]pyren-1-yl]-6-(3-pyridin-4-ylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 146230593 |
| Molecular Formula | C64H38N8 |
| Molecular Weight | 919.06 g/mol |
| Exact Mass | 918.32 |
| IUPAC Name | 2-naphthalen-1-yl-4-[6-[4-naphthalen-1-yl-6-(3-pyridin-4-ylphenyl)-1,3,5-triazin-2-yl]pyren-1-yl]-6-(3-pyridin-4-ylphenyl)-1,3,5-triazine |
| SMILES | c1cc(-c2ccncc2)cc(-c2nc(-c3cccc4ccccc34)nc(-c3ccc4ccc5c(-c6nc(-c7cccc(-c8ccncc8)c7)nc(-c7cccc8ccccc78)n6)ccc6ccc3c4c65)n2)c1 |
| InChI | InChI=1S/C64H38N8/c1-3-17-49-41(9-1)11-7-19-53(49)61-67-59(47-15-5-13-45(37-47)39-29-33-65-34-30-39)69-63(71-61)55-27-23-43-22-26-52-56(28-24-44-21-25-51(55)57(43)58(44)52)64-70-60(48-16-6-14-46(38-48)40-31-35-66-36-32-40)68-62(72-64)54-20-8-12-42-10-2-4-18-50(42)54/h1-38H |
| InChIKey | VUSSKLSLPDCPNK-UHFFFAOYSA-N |
| XLogP | 15.39 |
| TPSA | 103.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 919.06 |
| LogP ≤ 5 | 15.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|