C62H36N10 — CID 146230622
6-[4-[6-[4-isoquinolin-6-yl-6-(4-pyridin-2-ylphenyl)-1,3,5-triazin-2-yl]pyren-1-yl]-6-(4-pyridin-2-ylphenyl)-1,3,5-triazin-2-yl]isoquinoline (PubChem CID 146230622) has the molecular formula C62H36N10 and a molecular weight of 921.04 g/mol. Its IUPAC name is 6-[4-[6-[4-isoquinolin-6-yl-6-(4-pyridin-2-ylphenyl)-1,3,5-triazin-2-yl]pyren-1-yl]-6-(4-pyridin-2-ylphenyl)-1,3,5-triazin-2-yl]isoquinoline.
| Compound Name | 6-[4-[6-[4-isoquinolin-6-yl-6-(4-pyridin-2-ylphenyl)-1,3,5-triazin-2-yl]pyren-1-yl]-6-(4-pyridin-2-ylphenyl)-1,3,5-triazin-2-yl]isoquinoline |
|---|---|
| PubChem CID | 146230622 |
| Molecular Formula | C62H36N10 |
| Molecular Weight | 921.04 g/mol |
| Exact Mass | 920.31 |
| IUPAC Name | 6-[4-[6-[4-isoquinolin-6-yl-6-(4-pyridin-2-ylphenyl)-1,3,5-triazin-2-yl]pyren-1-yl]-6-(4-pyridin-2-ylphenyl)-1,3,5-triazin-2-yl]isoquinoline |
| SMILES | c1ccc(-c2ccc(-c3nc(-c4ccc5cnccc5c4)nc(-c4ccc5ccc6c(-c7nc(-c8ccc(-c9ccccn9)cc8)nc(-c8ccc9cnccc9c8)n7)ccc7ccc4c5c76)n3)cc2)nc1 |
| InChI | InChI=1S/C62H36N10/c1-3-29-65-53(5-1)37-7-11-41(12-8-37)57-67-59(45-15-17-47-35-63-31-27-43(47)33-45)71-61(69-57)51-25-21-39-20-24-50-52(26-22-40-19-23-49(51)55(39)56(40)50)62-70-58(42-13-9-38(10-14-42)54-6-2-4-30-66-54)68-60(72-62)46-16-18-48-36-64-32-28-44(48)34-46/h1-36H |
| InChIKey | CLYYNGKYFDKXOV-UHFFFAOYSA-N |
| XLogP | 14.18 |
| TPSA | 128.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 921.04 |
| LogP ≤ 5 | 14.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|