C19H32O6S2 — CID 146231144
4-[(5,7-ditert-butyl-2,3-dihydrothieno[3,4-b][1,4]dioxin-3-yl)methoxy]butane-2-sulfonic acid (PubChem CID 146231144) has the molecular formula C19H32O6S2 and a molecular weight of 420.59 g/mol. Its IUPAC name is 4-[(5,7-ditert-butyl-2,3-dihydrothieno[3,4-b][1,4]dioxin-3-yl)methoxy]butane-2-sulfonic acid.
| Compound Name | 4-[(5,7-ditert-butyl-2,3-dihydrothieno[3,4-b][1,4]dioxin-3-yl)methoxy]butane-2-sulfonic acid |
|---|---|
| PubChem CID | 146231144 |
| Molecular Formula | C19H32O6S2 |
| Molecular Weight | 420.59 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | 4-[(5,7-ditert-butyl-2,3-dihydrothieno[3,4-b][1,4]dioxin-3-yl)methoxy]butane-2-sulfonic acid |
| SMILES | CC(CCOCC1COc2c(C(C)(C)C)sc(C(C)(C)C)c2O1)S(=O)(=O)O |
| InChI | InChI=1S/C19H32O6S2/c1-12(27(20,21)22)8-9-23-10-13-11-24-14-15(25-13)17(19(5,6)7)26-16(14)18(2,3)4/h12-13H,8-11H2,1-7H3,(H,20,21,22) |
| InChIKey | DJEPUVYFUPEBSM-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.59 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|